C14H13F3 — CID 145089374
1-[(1E)-4-methyl-3-methylidenepenta-1,4-dienyl]-4-(trifluoromethyl)benzene (PubChem CID 145089374) has the molecular formula C14H13F3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[(1E)-4-methyl-3-methylidenepenta-1,4-dienyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1E)-4-methyl-3-methylidenepenta-1,4-dienyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 145089374 |
| Molecular Formula | C14H13F3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-[(1E)-4-methyl-3-methylidenepenta-1,4-dienyl]-4-(trifluoromethyl)benzene |
| SMILES | C=C(C)C(=C)/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3/c1-10(2)11(3)4-5-12-6-8-13(9-7-12)14(15,16)17/h4-9H,1,3H2,2H3/b5-4+ |
| InChIKey | DEXKGEPXJOXPMM-SNAWJCMRSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|