C11H9F3 — CID 11148298
1-[(1E)-buta-1,3-dienyl]-4-(trifluoromethyl)benzene (PubChem CID 11148298) has the molecular formula C11H9F3 and a molecular weight of 198.19 g/mol. Its IUPAC name is 1-[(1E)-buta-1,3-dienyl]-4-(trifluoromethyl)benzene.
| Compound Name | 1-[(1E)-buta-1,3-dienyl]-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 11148298 |
| Molecular Formula | C11H9F3 |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1-[(1E)-buta-1,3-dienyl]-4-(trifluoromethyl)benzene |
| SMILES | C=C/C=C/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F3/c1-2-3-4-9-5-7-10(8-6-9)11(12,13)14/h2-8H,1H2/b4-3+ |
| InChIKey | BKIGIIQTVZFVSW-ONEGZZNKSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|