C19H20F3N — CID 89087487
2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]butan-2-amine (PubChem CID 89087487) has the molecular formula C19H20F3N and a molecular weight of 319.37 g/mol. Its IUPAC name is 2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]butan-2-amine.
| Compound Name | 2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 89087487 |
| Molecular Formula | C19H20F3N |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]phenyl]butan-2-amine |
| SMILES | CCC(C)(N)c1ccc(/C=C/c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H20F3N/c1-3-18(2,23)16-10-6-14(7-11-16)4-5-15-8-12-17(13-9-15)19(20,21)22/h4-13H,3,23H2,1-2H3/b5-4+ |
| InChIKey | RUHLOHUKSHTPNN-SNAWJCMRSA-N |
| XLogP | 5.46 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|