C31H39N — CID 143743214
butane;2-[4-[(E)-2-(9,9-dimethylfluoren-2-yl)ethenyl]phenyl]butan-2-amine (PubChem CID 143743214) has the molecular formula C31H39N and a molecular weight of 425.66 g/mol. Its IUPAC name is butane;2-[4-[(E)-2-(9,9-dimethylfluoren-2-yl)ethenyl]phenyl]butan-2-amine.
| Compound Name | butane;2-[4-[(E)-2-(9,9-dimethylfluoren-2-yl)ethenyl]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 143743214 |
| Molecular Formula | C31H39N |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | butane;2-[4-[(E)-2-(9,9-dimethylfluoren-2-yl)ethenyl]phenyl]butan-2-amine |
| SMILES | CCC(C)(N)c1ccc(/C=C/c2ccc3c(c2)C(C)(C)c2ccccc2-3)cc1.CCCC |
| InChI | InChI=1S/C27H29N.C4H10/c1-5-27(4,28)21-15-12-19(13-16-21)10-11-20-14-17-23-22-8-6-7-9-24(22)26(2,3)25(23)18-20;1-3-4-2/h6-18H,5,28H2,1-4H3;3-4H2,1-2H3/b11-10+; |
| InChIKey | JJZJOUPNEXWSDT-ASTDGNLGSA-N |
| XLogP | 8.55 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|