C18H16O2 — CID 169461084
3-(9,9-dimethylfluoren-2-yl)prop-2-enoic acid (PubChem CID 169461084) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-(9,9-dimethylfluoren-2-yl)prop-2-enoic acid.
| Compound Name | 3-(9,9-dimethylfluoren-2-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 169461084 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 3-(9,9-dimethylfluoren-2-yl)prop-2-enoic acid |
| SMILES | CC1(C)c2ccccc2-c2ccc(C=CC(=O)O)cc21 |
| InChI | InChI=1S/C18H16O2/c1-18(2)15-6-4-3-5-13(15)14-9-7-12(11-16(14)18)8-10-17(19)20/h3-11H,1-2H3,(H,19,20) |
| InChIKey | OZPJSPGDYXAIAC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|