C31H20O5 — CID 175176320
3-[6'-(2-carboxyethenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]prop-2-enoic acid (PubChem CID 175176320) has the molecular formula C31H20O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is 3-[6'-(2-carboxyethenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]prop-2-enoic acid.
| Compound Name | 3-[6'-(2-carboxyethenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175176320 |
| Molecular Formula | C31H20O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 3-[6'-(2-carboxyethenyl)spiro[fluorene-9,9'-xanthene]-3'-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)Oc1cc(C=CC(=O)O)ccc1C21c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H20O5/c32-29(33)15-11-19-9-13-25-27(17-19)36-28-18-20(12-16-30(34)35)10-14-26(28)31(25)23-7-3-1-5-21(23)22-6-2-4-8-24(22)31/h1-18H,(H,32,33)(H,34,35) |
| InChIKey | XNIITVZMZCFRBJ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|