C25H26O — CID 144597281
(E)-3-[9,9-dimethyl-7-[(1Z,3Z)-3-methylpenta-1,3-dienyl]fluoren-3-yl]-2-methylprop-2-enal (PubChem CID 144597281) has the molecular formula C25H26O and a molecular weight of 342.48 g/mol. Its IUPAC name is (E)-3-[9,9-dimethyl-7-[(1Z,3Z)-3-methylpenta-1,3-dienyl]fluoren-3-yl]-2-methylprop-2-enal.
| Compound Name | (E)-3-[9,9-dimethyl-7-[(1Z,3Z)-3-methylpenta-1,3-dienyl]fluoren-3-yl]-2-methylprop-2-enal |
|---|---|
| PubChem CID | 144597281 |
| Molecular Formula | C25H26O |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (E)-3-[9,9-dimethyl-7-[(1Z,3Z)-3-methylpenta-1,3-dienyl]fluoren-3-yl]-2-methylprop-2-enal |
| SMILES | C/C=C(C)\C=C/c1ccc2c(c1)C(C)(C)c1ccc(/C=C(\C)C=O)cc1-2 |
| InChI | InChI=1S/C25H26O/c1-6-17(2)7-8-19-9-11-21-22-14-20(13-18(3)16-26)10-12-23(22)25(4,5)24(21)15-19/h6-16H,1-5H3/b8-7-,17-6-,18-13+ |
| InChIKey | JEGDIDDAYHXAFS-CDQKRWFVSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|