C32H35N — CID 143938134
N-(3,4-diethylphenyl)-7-[(1E,3E)-3-ethenylpenta-1,3-dienyl]-9,9-dimethylfluoren-2-amine (PubChem CID 143938134) has the molecular formula C32H35N and a molecular weight of 433.64 g/mol. Its IUPAC name is N-(3,4-diethylphenyl)-7-[(1E,3E)-3-ethenylpenta-1,3-dienyl]-9,9-dimethylfluoren-2-amine.
| Compound Name | N-(3,4-diethylphenyl)-7-[(1E,3E)-3-ethenylpenta-1,3-dienyl]-9,9-dimethylfluoren-2-amine |
|---|---|
| PubChem CID | 143938134 |
| Molecular Formula | C32H35N |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-(3,4-diethylphenyl)-7-[(1E,3E)-3-ethenylpenta-1,3-dienyl]-9,9-dimethylfluoren-2-amine |
| SMILES | C=CC(/C=C/c1ccc2c(c1)C(C)(C)c1cc(Nc3ccc(CC)c(CC)c3)ccc1-2)=C\C |
| InChI | InChI=1S/C32H35N/c1-7-22(8-2)11-12-23-13-17-28-29-18-16-27(21-31(29)32(5,6)30(28)19-23)33-26-15-14-24(9-3)25(10-4)20-26/h7-8,11-21,33H,1,9-10H2,2-6H3/b12-11+,22-8+ |
| InChIKey | ALKFKYVDECSWSA-BVIJOURBSA-N |
| XLogP | 9.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|