C19H20 — CID 20593657
2,9,9-trimethyl-7-[(E)-prop-1-enyl]fluorene (PubChem CID 20593657) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2,9,9-trimethyl-7-[(E)-prop-1-enyl]fluorene.
| Compound Name | 2,9,9-trimethyl-7-[(E)-prop-1-enyl]fluorene |
|---|---|
| PubChem CID | 20593657 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2,9,9-trimethyl-7-[(E)-prop-1-enyl]fluorene |
| SMILES | C/C=C/c1ccc2c(c1)C(C)(C)c1cc(C)ccc1-2 |
| InChI | InChI=1S/C19H20/c1-5-6-14-8-10-16-15-9-7-13(2)11-17(15)19(3,4)18(16)12-14/h5-12H,1-4H3/b6-5+ |
| InChIKey | RIXJASRLSXRPTD-AATRIKPKSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |