C19H23N — CID 70641823
2-[4-[(E)-2-phenylethenyl]phenyl]pentan-2-amine (PubChem CID 70641823) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-[4-[(E)-2-phenylethenyl]phenyl]pentan-2-amine.
| Compound Name | 2-[4-[(E)-2-phenylethenyl]phenyl]pentan-2-amine |
|---|---|
| PubChem CID | 70641823 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-[4-[(E)-2-phenylethenyl]phenyl]pentan-2-amine |
| SMILES | CCCC(C)(N)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N/c1-3-15-19(2,20)18-13-11-17(12-14-18)10-9-16-7-5-4-6-8-16/h4-14H,3,15,20H2,1-2H3/b10-9+ |
| InChIKey | BQMJLIRZSBXUHM-MDZDMXLPSA-N |
| XLogP | 4.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|