About 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene
1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene (PubChem CID 156513207) has the molecular formula C14H13F3
and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene |
| PubChem CID | 156513207 |
| Molecular Formula | C14H13F3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene |
| SMILES | C=C/C(C)=C\C(=C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H13F3/c1-4-10(2)9-11(3)12-5-7-13(8-6-12)14(15,16)17/h4-9H,1,3H2,2H3/b10-9- |
| InChIKey | HCMMVTVFUWKTNH-KTKRTIGZSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene?
The IUPAC name of 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene (CID 156513207) is 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene.
What is the SMILES notation for 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene?
The canonical SMILES for 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene is C=C/C(C)=C\C(=C)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene?
The InChIKey is HCMMVTVFUWKTNH-KTKRTIGZSA-N. The full InChI is InChI=1S/C14H13F3/c1-4-10(2)9-11(3)12-5-7-13(8-6-12)14(15,16)17/h4-9H,1,3H2,2H3/b10-9-.
What are the key properties of 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene?
1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene has a molecular weight of 238.25 g/mol, XLogP of 4.85, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-4-methylhexa-1,3,5-trien-2-yl]-4-(trifluoromethyl)benzene is sourced from PubChem (CID 156513207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).