C13H9F3N4 — CID 123518452
3-buta-1,3-dien-2-yl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine (PubChem CID 123518452) has the molecular formula C13H9F3N4 and a molecular weight of 278.24 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine.
| Compound Name | 3-buta-1,3-dien-2-yl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 123518452 |
| Molecular Formula | C13H9F3N4 |
| Molecular Weight | 278.24 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-6-[4-(trifluoromethyl)phenyl]-1,2,4,5-tetrazine |
| SMILES | C=CC(=C)c1nnc(-c2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C13H9F3N4/c1-3-8(2)11-17-19-12(20-18-11)9-4-6-10(7-5-9)13(14,15)16/h3-7H,1-2H2 |
| InChIKey | YTMWVYBSXSZCIN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|