C19H19F3N4 — CID 169204862
2-(4-buta-1,3-dien-2-ylpiperazin-1-yl)-3-[4-(trifluoromethyl)phenyl]pyrazine (PubChem CID 169204862) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 2-(4-buta-1,3-dien-2-ylpiperazin-1-yl)-3-[4-(trifluoromethyl)phenyl]pyrazine.
| Compound Name | 2-(4-buta-1,3-dien-2-ylpiperazin-1-yl)-3-[4-(trifluoromethyl)phenyl]pyrazine |
|---|---|
| PubChem CID | 169204862 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(4-buta-1,3-dien-2-ylpiperazin-1-yl)-3-[4-(trifluoromethyl)phenyl]pyrazine |
| SMILES | C=CC(=C)N1CCN(c2nccnc2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N4/c1-3-14(2)25-10-12-26(13-11-25)18-17(23-8-9-24-18)15-4-6-16(7-5-15)19(20,21)22/h3-9H,1-2,10-13H2 |
| InChIKey | CPHVVFQOWIFNRY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|