C15H17Cl2F3N4 — CID 68595238
2-piperazin-1-yl-3-[3-(trifluoromethyl)phenyl]pyrazine;dihydrochloride (PubChem CID 68595238) has the molecular formula C15H17Cl2F3N4 and a molecular weight of 381.23 g/mol. Its IUPAC name is 2-piperazin-1-yl-3-[3-(trifluoromethyl)phenyl]pyrazine;dihydrochloride.
| Compound Name | 2-piperazin-1-yl-3-[3-(trifluoromethyl)phenyl]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 68595238 |
| Molecular Formula | C15H17Cl2F3N4 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-piperazin-1-yl-3-[3-(trifluoromethyl)phenyl]pyrazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cccc(-c2nccnc2N2CCNCC2)c1 |
| InChI | InChI=1S/C15H15F3N4.2ClH/c16-15(17,18)12-3-1-2-11(10-12)13-14(21-5-4-20-13)22-8-6-19-7-9-22;;/h1-5,10,19H,6-9H2;2*1H |
| InChIKey | QICDBFVUNNXUAQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |