C16H14F3N5 — CID 143957400
5-piperazin-1-yl-9-(trifluoromethyl)pyrazino[2,3-c]quinoline (PubChem CID 143957400) has the molecular formula C16H14F3N5 and a molecular weight of 333.32 g/mol. Its IUPAC name is 5-piperazin-1-yl-9-(trifluoromethyl)pyrazino[2,3-c]quinoline.
| Compound Name | 5-piperazin-1-yl-9-(trifluoromethyl)pyrazino[2,3-c]quinoline |
|---|---|
| PubChem CID | 143957400 |
| Molecular Formula | C16H14F3N5 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 5-piperazin-1-yl-9-(trifluoromethyl)pyrazino[2,3-c]quinoline |
| SMILES | FC(F)(F)c1ccc2nc(N3CCNCC3)c3nccnc3c2c1 |
| InChI | InChI=1S/C16H14F3N5/c17-16(18,19)10-1-2-12-11(9-10)13-14(22-4-3-21-13)15(23-12)24-7-5-20-6-8-24/h1-4,9,20H,5-8H2 |
| InChIKey | ZDHOBZZDFFYPBI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|