C12H13ClF6N2 — CID 130454922
1-[2,5-bis(trifluoromethyl)phenyl]piperazine;hydrochloride (PubChem CID 130454922) has the molecular formula C12H13ClF6N2 and a molecular weight of 334.69 g/mol. Its IUPAC name is 1-[2,5-bis(trifluoromethyl)phenyl]piperazine;hydrochloride.
| Compound Name | 1-[2,5-bis(trifluoromethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 130454922 |
| Molecular Formula | C12H13ClF6N2 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 1-[2,5-bis(trifluoromethyl)phenyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1ccc(C(F)(F)F)c(N2CCNCC2)c1 |
| InChI | InChI=1S/C12H12F6N2.ClH/c13-11(14,15)8-1-2-9(12(16,17)18)10(7-8)20-5-3-19-4-6-20;/h1-2,7,19H,3-6H2;1H |
| InChIKey | UAPOLRGVBQSXDU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |