C18H16F6N2S — CID 177359911
1-[2-[2,4-bis(trifluoromethyl)phenyl]sulfanylphenyl]piperazine (PubChem CID 177359911) has the molecular formula C18H16F6N2S and a molecular weight of 406.40 g/mol. Its IUPAC name is 1-[2-[2,4-bis(trifluoromethyl)phenyl]sulfanylphenyl]piperazine.
| Compound Name | 1-[2-[2,4-bis(trifluoromethyl)phenyl]sulfanylphenyl]piperazine |
|---|---|
| PubChem CID | 177359911 |
| Molecular Formula | C18H16F6N2S |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[2-[2,4-bis(trifluoromethyl)phenyl]sulfanylphenyl]piperazine |
| SMILES | FC(F)(F)c1ccc(Sc2ccccc2N2CCNCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H16F6N2S/c19-17(20,21)12-5-6-15(13(11-12)18(22,23)24)27-16-4-2-1-3-14(16)26-9-7-25-8-10-26/h1-6,11,25H,7-10H2 |
| InChIKey | CRAHKVCJMKYUIM-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |