C22H30N2S — CID 145260602
acetylene;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;ethane (PubChem CID 145260602) has the molecular formula C22H30N2S and a molecular weight of 354.56 g/mol. Its IUPAC name is acetylene;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;ethane.
| Compound Name | acetylene;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;ethane |
|---|---|
| PubChem CID | 145260602 |
| Molecular Formula | C22H30N2S |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | acetylene;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;ethane |
| SMILES | C#C.CC.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2S.C2H6.C2H2/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;2*1-2/h3-8,13,19H,9-12H2,1-2H3;1-2H3;1-2H |
| InChIKey | VGSGRILZOIUGDD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|