C18H22N2OS — CID 126620896
4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-2-ol (PubChem CID 126620896) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-2-ol.
| Compound Name | 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-2-ol |
|---|---|
| PubChem CID | 126620896 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-2-ol |
| SMILES | Cc1ccc(Sc2ccccc2N2CCNC(O)C2)c(C)c1 |
| InChI | InChI=1S/C18H22N2OS/c1-13-7-8-16(14(2)11-13)22-17-6-4-3-5-15(17)20-10-9-19-18(21)12-20/h3-8,11,18-19,21H,9-10,12H2,1-2H3 |
| InChIKey | VGDHGCOYOFXHOU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |