About [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate
[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate (PubChem CID 130453931) has the molecular formula C20H24N2O3S
and a molecular weight of 372.49 g/mol. Its IUPAC name is [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate.
Molecular Properties
| Compound Name | [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate |
| PubChem CID | 130453931 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(COC(=O)O)CC2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O3S/c1-15-7-8-18(16(2)13-15)26-19-6-4-3-5-17(19)22-11-9-21(10-12-22)14-25-20(23)24/h3-8,13H,9-12,14H2,1-2H3,(H,23,24) |
| InChIKey | AKKNBEFJVIJPOS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate?
The IUPAC name of [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate (CID 130453931) is [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate.
What is the SMILES notation for [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate?
The canonical SMILES for [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate is Cc1ccc(Sc2ccccc2N2CCN(COC(=O)O)CC2)c(C)c1.
What is the InChIKey of [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate?
The InChIKey is AKKNBEFJVIJPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3S/c1-15-7-8-18(16(2)13-15)26-19-6-4-3-5-17(19)22-11-9-21(10-12-22)14-25-20(23)24/h3-8,13H,9-12,14H2,1-2H3,(H,23,24).
What are the key properties of [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate?
[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate has a molecular weight of 372.49 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl hydrogen carbonate is sourced from PubChem (CID 130453931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).