C43H52N4O4S2 — CID 130454033
bis[[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl] 2,2-dimethylpropanedioate (PubChem CID 130454033) has the molecular formula C43H52N4O4S2 and a molecular weight of 753.05 g/mol. Its IUPAC name is bis[[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl] 2,2-dimethylpropanedioate.
| Compound Name | bis[[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl] 2,2-dimethylpropanedioate |
|---|---|
| PubChem CID | 130454033 |
| Molecular Formula | C43H52N4O4S2 |
| Molecular Weight | 753.05 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | bis[[4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazin-1-yl]methyl] 2,2-dimethylpropanedioate |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(COC(=O)C(C)(C)C(=O)OCN3CCN(c4ccccc4Sc4ccc(C)cc4C)CC3)CC2)c(C)c1 |
| InChI | InChI=1S/C43H52N4O4S2/c1-31-15-17-37(33(3)27-31)52-39-13-9-7-11-35(39)46-23-19-44(20-24-46)29-50-41(48)43(5,6)42(49)51-30-45-21-25-47(26-22-45)36-12-8-10-14-40(36)53-38-18-16-32(2)28-34(38)4/h7-18,27-28H,19-26,29-30H2,1-6H3 |
| InChIKey | FFNQWRQIESYTJR-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.05 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|