C22H27ClN2O2S — CID 53239043
tert-butyl 4-[2-(2-chloro-4-methylphenyl)sulfanylphenyl]piperazine-1-carboxylate (PubChem CID 53239043) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-chloro-4-methylphenyl)sulfanylphenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-chloro-4-methylphenyl)sulfanylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 53239043 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | tert-butyl 4-[2-(2-chloro-4-methylphenyl)sulfanylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(C(=O)OC(C)(C)C)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O2S/c1-16-9-10-19(17(23)15-16)28-20-8-6-5-7-18(20)24-11-13-25(14-12-24)21(26)27-22(2,3)4/h5-10,15H,11-14H2,1-4H3 |
| InChIKey | JYECYNYZUZEHSX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |