C20H26N4O2S — CID 141426246
tert-butyl 4-(4-methyl-2-pyrimidin-2-ylsulfanylphenyl)piperazine-1-carboxylate (PubChem CID 141426246) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is tert-butyl 4-(4-methyl-2-pyrimidin-2-ylsulfanylphenyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methyl-2-pyrimidin-2-ylsulfanylphenyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141426246 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | tert-butyl 4-(4-methyl-2-pyrimidin-2-ylsulfanylphenyl)piperazine-1-carboxylate |
| SMILES | Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(Sc2ncccn2)c1 |
| InChI | InChI=1S/C20H26N4O2S/c1-15-6-7-16(17(14-15)27-18-21-8-5-9-22-18)23-10-12-24(13-11-23)19(25)26-20(2,3)4/h5-9,14H,10-13H2,1-4H3 |
| InChIKey | NPWVBTWTVWXCRQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |