About 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid (PubChem CID 118277120) has the molecular formula C20H24N2O4S
and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid.
Molecular Properties
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid |
| PubChem CID | 118277120 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid |
| SMILES | Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22N2S.C2H2O4/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;3-1(4)2(5)6/h3-8,13,19H,9-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OUTVWTFERZZVKT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid?
The IUPAC name of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid (CID 118277120) is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid.
What is the SMILES notation for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid?
The canonical SMILES for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid is Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.O=C(O)C(=O)O.
What is the InChIKey of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid?
The InChIKey is OUTVWTFERZZVKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2S.C2H2O4/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;3-1(4)2(5)6/h3-8,13,19H,9-12H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid?
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid has a molecular weight of 388.49 g/mol, XLogP of 3.02, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid is sourced from PubChem (CID 118277120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).