C20H24N2O4S — CID 118277120
1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid (PubChem CID 118277120) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid.
| Compound Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 118277120 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine;oxalic acid |
| SMILES | Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22N2S.C2H2O4/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;3-1(4)2(5)6/h3-8,13,19H,9-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | OUTVWTFERZZVKT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|