C38H46N4O4S2 — CID 172741870
bis(1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine);oxalic acid (PubChem CID 172741870) has the molecular formula C38H46N4O4S2 and a molecular weight of 686.94 g/mol. Its IUPAC name is bis(1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine);oxalic acid.
| Compound Name | bis(1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine);oxalic acid |
|---|---|
| PubChem CID | 172741870 |
| Molecular Formula | C38H46N4O4S2 |
| Molecular Weight | 686.94 g/mol |
| Exact Mass | 686.30 |
| IUPAC Name | bis(1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine);oxalic acid |
| SMILES | Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C18H22N2S.C2H2O4/c2*1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;3-1(4)2(5)6/h2*3-8,13,19H,9-12H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | JFARVUFQYUDZNV-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.94 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|