C32H37N3S2 — CID 159928623
2-(2,4-dimethylphenyl)sulfanylaniline;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine (PubChem CID 159928623) has the molecular formula C32H37N3S2 and a molecular weight of 527.80 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)sulfanylaniline;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine.
| Compound Name | 2-(2,4-dimethylphenyl)sulfanylaniline;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine |
|---|---|
| PubChem CID | 159928623 |
| Molecular Formula | C32H37N3S2 |
| Molecular Weight | 527.80 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 2-(2,4-dimethylphenyl)sulfanylaniline;1-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine |
| SMILES | Cc1ccc(Sc2ccccc2N)c(C)c1.Cc1ccc(Sc2ccccc2N2CCNCC2)c(C)c1 |
| InChI | InChI=1S/C18H22N2S.C14H15NS/c1-14-7-8-17(15(2)13-14)21-18-6-4-3-5-16(18)20-11-9-19-10-12-20;1-10-7-8-13(11(2)9-10)16-14-6-4-3-5-12(14)15/h3-8,13,19H,9-12H2,1-2H3;3-9H,15H2,1-2H3 |
| InChIKey | NZIQMNFNMWMKCT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.80 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|