C26H33N3O4S — CID 130453875
3-(oxetane-3-carbonylamino)propyl 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine-1-carboxylate (PubChem CID 130453875) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 3-(oxetane-3-carbonylamino)propyl 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine-1-carboxylate.
| Compound Name | 3-(oxetane-3-carbonylamino)propyl 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 130453875 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 3-(oxetane-3-carbonylamino)propyl 4-[2-(2,4-dimethylphenyl)sulfanylphenyl]piperazine-1-carboxylate |
| SMILES | Cc1ccc(Sc2ccccc2N2CCN(C(=O)OCCCNC(=O)C3COC3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H33N3O4S/c1-19-8-9-23(20(2)16-19)34-24-7-4-3-6-22(24)28-11-13-29(14-12-28)26(31)33-15-5-10-27-25(30)21-17-32-18-21/h3-4,6-9,16,21H,5,10-15,17-18H2,1-2H3,(H,27,30) |
| InChIKey | NJSIUTCRTDKDPN-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|