C19H20F3N5O2 — CID 172634926
1-[(2R)-2-(hydroxymethyl)-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 172634926) has the molecular formula C19H20F3N5O2 and a molecular weight of 407.40 g/mol. Its IUPAC name is 1-[(2R)-2-(hydroxymethyl)-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R)-2-(hydroxymethyl)-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 172634926 |
| Molecular Formula | C19H20F3N5O2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 1-[(2R)-2-(hydroxymethyl)-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nccnc2Nc2ccc(C(F)(F)F)cc2)C[C@@H]1CO |
| InChI | InChI=1S/C19H20F3N5O2/c1-2-16(29)27-10-9-26(11-15(27)12-28)18-17(23-7-8-24-18)25-14-5-3-13(4-6-14)19(20,21)22/h2-8,15,28H,1,9-12H2,(H,23,25)/t15-/m1/s1 |
| InChIKey | MMNBFNGSVNIKEF-OAHLLOKOSA-N |
| XLogP | 2.43 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|