C16H16F3N5O2 — CID 170161346
4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxylic acid (PubChem CID 170161346) has the molecular formula C16H16F3N5O2 and a molecular weight of 367.33 g/mol. Its IUPAC name is 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxylic acid.
| Compound Name | 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 170161346 |
| Molecular Formula | C16H16F3N5O2 |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(c2nccnc2Nc2ccc(C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C16H16F3N5O2/c17-16(18,19)10-1-3-11(4-2-10)23-13-14(22-6-5-21-13)24-8-7-20-12(9-24)15(25)26/h1-6,12,20H,7-9H2,(H,21,23)(H,25,26) |
| InChIKey | NVHZRBHWAUHMTK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |