C21H25F3N4O2 — CID 170172496
tert-butyl 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperidine-1-carboxylate (PubChem CID 170172496) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is tert-butyl 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170172496 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | tert-butyl 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nccnc2Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H25F3N4O2/c1-20(2,3)30-19(29)28-12-8-14(9-13-28)17-18(26-11-10-25-17)27-16-6-4-15(5-7-16)21(22,23)24/h4-7,10-11,14H,8-9,12-13H2,1-3H3,(H,26,27) |
| InChIKey | AYESCHUYQIOQMN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |