C26H30N4O3 — CID 59374012
tert-butyl 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperidine-1-carboxylate (PubChem CID 59374012) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59374012 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | tert-butyl 4-[2-[4-(pyridin-2-ylamino)phenoxy]-3-pyridinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccnc2Oc2ccc(Nc3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C26H30N4O3/c1-26(2,3)33-25(31)30-17-13-19(14-18-30)22-7-6-16-28-24(22)32-21-11-9-20(10-12-21)29-23-8-4-5-15-27-23/h4-12,15-16,19H,13-14,17-18H2,1-3H3,(H,27,29) |
| InChIKey | VKAYJWUELOYSIE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |