C21H21N5O3 — CID 67425066
4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-1-carboxylic acid (PubChem CID 67425066) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67425066 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 4-[3-[4-(pyridin-2-ylamino)phenoxy]pyrazin-2-yl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2nccnc2Oc2ccc(Nc3ccccn3)cc2)CC1 |
| InChI | InChI=1S/C21H21N5O3/c27-21(28)26-13-8-15(9-14-26)19-20(24-12-11-23-19)29-17-6-4-16(5-7-17)25-18-3-1-2-10-22-18/h1-7,10-12,15H,8-9,13-14H2,(H,22,25)(H,27,28) |
| InChIKey | CXLXLDLXBSQLBI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |