C23H26F3N5O2 — CID 170162414
tert-butyl (2S)-2-prop-2-ynyl-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-1-carboxylate (PubChem CID 170162414) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-prop-2-ynyl-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-prop-2-ynyl-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170162414 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | tert-butyl (2S)-2-prop-2-ynyl-4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-1-carboxylate |
| SMILES | C#CC[C@H]1CN(c2nccnc2Nc2ccc(C(F)(F)F)cc2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H26F3N5O2/c1-5-6-18-15-30(13-14-31(18)21(32)33-22(2,3)4)20-19(27-11-12-28-20)29-17-9-7-16(8-10-17)23(24,25)26/h1,7-12,18H,6,13-15H2,2-4H3,(H,27,29)/t18-/m0/s1 |
| InChIKey | PPCWWSXXXREWEL-SFHVURJKSA-N |
| XLogP | 4.69 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|