C16H17F3N6O — CID 170163113
4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxamide (PubChem CID 170163113) has the molecular formula C16H17F3N6O and a molecular weight of 366.35 g/mol. Its IUPAC name is 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxamide.
| Compound Name | 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 170163113 |
| Molecular Formula | C16H17F3N6O |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[3-[4-(trifluoromethyl)anilino]pyrazin-2-yl]piperazine-2-carboxamide |
| SMILES | NC(=O)C1CN(c2nccnc2Nc2ccc(C(F)(F)F)cc2)CCN1 |
| InChI | InChI=1S/C16H17F3N6O/c17-16(18,19)10-1-3-11(4-2-10)24-14-15(23-6-5-22-14)25-8-7-21-12(9-25)13(20)26/h1-6,12,21H,7-9H2,(H2,20,26)(H,22,24) |
| InChIKey | WVPFIEIUTZLQRN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |