C13H10F3N3O — CID 12812716
2-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 12812716) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | 2-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 12812716 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F3N3O/c14-13(15,16)8-3-5-9(6-4-8)19-12-10(11(17)20)2-1-7-18-12/h1-7H,(H2,17,20)(H,18,19) |
| InChIKey | BNOGDBCQVREPNK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |