C22H29F3N2O2 — CID 157164217
tert-butyl 2-butyl-4-[4-ethynyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate (PubChem CID 157164217) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is tert-butyl 2-butyl-4-[4-ethynyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-butyl-4-[4-ethynyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 157164217 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl 2-butyl-4-[4-ethynyl-2-(trifluoromethyl)phenyl]piperazine-1-carboxylate |
| SMILES | C#Cc1ccc(N2CCN(C(=O)OC(C)(C)C)C(CCCC)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H29F3N2O2/c1-6-8-9-17-15-26(12-13-27(17)20(28)29-21(3,4)5)19-11-10-16(7-2)14-18(19)22(23,24)25/h2,10-11,14,17H,6,8-9,12-13,15H2,1,3-5H3 |
| InChIKey | AMSJJUOFJOLGIR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|