C21H28F3N3O2 — CID 141412655
tert-butyl 2-tert-butyl-4-[5-ethynyl-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 141412655) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is tert-butyl 2-tert-butyl-4-[5-ethynyl-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 2-tert-butyl-4-[5-ethynyl-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141412655 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | tert-butyl 2-tert-butyl-4-[5-ethynyl-3-(trifluoromethyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | C#Cc1cnc(N2CCN(C(=O)OC(C)(C)C)C(C(C)(C)C)C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H28F3N3O2/c1-8-14-11-15(21(22,23)24)17(25-12-14)26-9-10-27(16(13-26)19(2,3)4)18(28)29-20(5,6)7/h1,11-12,16H,9-10,13H2,2-7H3 |
| InChIKey | LZEROYFPSVVXMN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|