C15H21F3N4O2 — CID 167442296
tert-butyl (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 167442296) has the molecular formula C15H21F3N4O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 167442296 |
| Molecular Formula | C15H21F3N4O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | tert-butyl (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(c2ncc(C(F)(F)F)cn2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21F3N4O2/c1-10-9-21(5-6-22(10)13(23)24-14(2,3)4)12-19-7-11(8-20-12)15(16,17)18/h7-8,10H,5-6,9H2,1-4H3/t10-/m0/s1 |
| InChIKey | PIRVHPWMVNKDGC-JTQLQIEISA-N |
| XLogP | 2.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |