C11H13F3N4O2 — CID 174238746
(2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid (PubChem CID 174238746) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.25 g/mol. Its IUPAC name is (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid.
| Compound Name | (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174238746 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | (2S)-2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(c2ncc(C(F)(F)F)cn2)CCN1C(=O)O |
| InChI | InChI=1S/C11H13F3N4O2/c1-7-6-17(2-3-18(7)10(19)20)9-15-4-8(5-16-9)11(12,13)14/h4-5,7H,2-3,6H2,1H3,(H,19,20)/t7-/m0/s1 |
| InChIKey | REXPEMABCPAUHE-ZETCQYMHSA-N |
| XLogP | 1.68 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |