C12H12F3N3O4 — CID 90744981
4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1,2-dicarboxylic acid (PubChem CID 90744981) has the molecular formula C12H12F3N3O4 and a molecular weight of 319.24 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1,2-dicarboxylic acid.
| Compound Name | 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 90744981 |
| Molecular Formula | C12H12F3N3O4 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc(C(F)(F)F)cn2)CCN1C(=O)O |
| InChI | InChI=1S/C12H12F3N3O4/c13-12(14,15)7-1-2-9(16-5-7)17-3-4-18(11(21)22)8(6-17)10(19)20/h1-2,5,8H,3-4,6H2,(H,19,20)(H,21,22) |
| InChIKey | KXIIYBAUULQMTD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |