C11H12FN3O4 — CID 174202611
4-(5-fluoro-2-pyridinyl)piperazine-1,2-dicarboxylic acid (PubChem CID 174202611) has the molecular formula C11H12FN3O4 and a molecular weight of 269.23 g/mol. Its IUPAC name is 4-(5-fluoro-2-pyridinyl)piperazine-1,2-dicarboxylic acid.
| Compound Name | 4-(5-fluoro-2-pyridinyl)piperazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 174202611 |
| Molecular Formula | C11H12FN3O4 |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-(5-fluoro-2-pyridinyl)piperazine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CN(c2ccc(F)cn2)CCN1C(=O)O |
| InChI | InChI=1S/C11H12FN3O4/c12-7-1-2-9(13-5-7)14-3-4-15(11(18)19)8(6-14)10(16)17/h1-2,5,8H,3-4,6H2,(H,16,17)(H,18,19) |
| InChIKey | VISCVNNAINSBEQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |