C11H14ClFN2 — CID 114682637
2-(4-chloro-3-methylpiperidin-1-yl)-5-fluoropyridine (PubChem CID 114682637) has the molecular formula C11H14ClFN2 and a molecular weight of 228.70 g/mol. Its IUPAC name is 2-(4-chloro-3-methylpiperidin-1-yl)-5-fluoropyridine.
| Compound Name | 2-(4-chloro-3-methylpiperidin-1-yl)-5-fluoropyridine |
|---|---|
| PubChem CID | 114682637 |
| Molecular Formula | C11H14ClFN2 |
| Molecular Weight | 228.70 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-(4-chloro-3-methylpiperidin-1-yl)-5-fluoropyridine |
| SMILES | CC1CN(c2ccc(F)cn2)CCC1Cl |
| InChI | InChI=1S/C11H14ClFN2/c1-8-7-15(5-4-10(8)12)11-3-2-9(13)6-14-11/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | BGBYAYNKIJYMQT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|