C13H20ClN3O2S — CID 103341441
6-(4-chloro-3-methylpiperidin-1-yl)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103341441) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 6-(4-chloro-3-methylpiperidin-1-yl)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(4-chloro-3-methylpiperidin-1-yl)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103341441 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 6-(4-chloro-3-methylpiperidin-1-yl)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CC1CN(c2ccc(S(=O)(=O)N(C)C)cn2)CCC1Cl |
| InChI | InChI=1S/C13H20ClN3O2S/c1-10-9-17(7-6-12(10)14)13-5-4-11(8-15-13)20(18,19)16(2)3/h4-5,8,10,12H,6-7,9H2,1-3H3 |
| InChIKey | YQNFFRUAFYIAKJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|