C12H17N3O4S2 — CID 103340906
4-[5-(dimethylsulfamoyl)-2-pyridinyl]thiomorpholine-3-carboxylic acid (PubChem CID 103340906) has the molecular formula C12H17N3O4S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[5-(dimethylsulfamoyl)-2-pyridinyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[5-(dimethylsulfamoyl)-2-pyridinyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 103340906 |
| Molecular Formula | C12H17N3O4S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 4-[5-(dimethylsulfamoyl)-2-pyridinyl]thiomorpholine-3-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(N2CCSCC2C(=O)O)nc1 |
| InChI | InChI=1S/C12H17N3O4S2/c1-14(2)21(18,19)9-3-4-11(13-7-9)15-5-6-20-8-10(15)12(16)17/h3-4,7,10H,5-6,8H2,1-2H3,(H,16,17) |
| InChIKey | SRYHJQJRYVCUII-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |