C9H10FN3O2S — CID 104606020
4-(5-fluoropyrimidin-2-yl)thiomorpholine-3-carboxylic acid (PubChem CID 104606020) has the molecular formula C9H10FN3O2S and a molecular weight of 243.26 g/mol. Its IUPAC name is 4-(5-fluoropyrimidin-2-yl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(5-fluoropyrimidin-2-yl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 104606020 |
| Molecular Formula | C9H10FN3O2S |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-(5-fluoropyrimidin-2-yl)thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1c1ncc(F)cn1 |
| InChI | InChI=1S/C9H10FN3O2S/c10-6-3-11-9(12-4-6)13-1-2-16-5-7(13)8(14)15/h3-4,7H,1-2,5H2,(H,14,15) |
| InChIKey | LAGAXCUERSYOQG-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |