C10H13N5O2S — CID 103341249
6-(3-aminopyrazol-1-yl)-N,N-dimethylpyridine-3-sulfonamide (PubChem CID 103341249) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-(3-aminopyrazol-1-yl)-N,N-dimethylpyridine-3-sulfonamide.
| Compound Name | 6-(3-aminopyrazol-1-yl)-N,N-dimethylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103341249 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 6-(3-aminopyrazol-1-yl)-N,N-dimethylpyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(-n2ccc(N)n2)nc1 |
| InChI | InChI=1S/C10H13N5O2S/c1-14(2)18(16,17)8-3-4-10(12-7-8)15-6-5-9(11)13-15/h3-7H,1-2H3,(H2,11,13) |
| InChIKey | WQRRLJNAYCKEIF-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |