C16H18F3N3O — CID 154831085
cyclopropyl-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]methanone (PubChem CID 154831085) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is cyclopropyl-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]methanone.
| Compound Name | cyclopropyl-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]methanone |
|---|---|
| PubChem CID | 154831085 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | cyclopropyl-[5-[5-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]methanone |
| SMILES | O=C(C1CC1)N1CCC2CN(c3ccc(C(F)(F)F)cn3)CC21 |
| InChI | InChI=1S/C16H18F3N3O/c17-16(18,19)12-3-4-14(20-7-12)21-8-11-5-6-22(13(11)9-21)15(23)10-1-2-10/h3-4,7,10-11,13H,1-2,5-6,8-9H2 |
| InChIKey | IPPVXTIOMXPKOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |