C23H25F3N6O3 — CID 165393091
5-[2-[3-[2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one (PubChem CID 165393091) has the molecular formula C23H25F3N6O3 and a molecular weight of 490.49 g/mol. Its IUPAC name is 5-[2-[3-[2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one.
| Compound Name | 5-[2-[3-[2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 165393091 |
| Molecular Formula | C23H25F3N6O3 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 5-[2-[3-[2-methyl-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2H-phthalazin-1-one |
| SMILES | CC1CN(c2ncc(C(F)(F)F)cn2)CCN1C(=O)CCOCCc1cccc2c(=O)[nH]ncc12 |
| InChI | InChI=1S/C23H25F3N6O3/c1-15-14-31(22-27-11-17(12-28-22)23(24,25)26)7-8-32(15)20(33)6-10-35-9-5-16-3-2-4-18-19(16)13-29-30-21(18)34/h2-4,11-13,15H,5-10,14H2,1H3,(H,30,34) |
| InChIKey | IYIRWIPJYDCJDB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|