C22H23F3N6O3 — CID 165392919
2-[2-(1-oxo-2H-phthalazin-5-yl)ethoxy]-N-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]acetamide (PubChem CID 165392919) has the molecular formula C22H23F3N6O3 and a molecular weight of 476.46 g/mol. Its IUPAC name is 2-[2-(1-oxo-2H-phthalazin-5-yl)ethoxy]-N-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]acetamide.
| Compound Name | 2-[2-(1-oxo-2H-phthalazin-5-yl)ethoxy]-N-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 165392919 |
| Molecular Formula | C22H23F3N6O3 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[2-(1-oxo-2H-phthalazin-5-yl)ethoxy]-N-[1-[5-(trifluoromethyl)pyrimidin-2-yl]piperidin-4-yl]acetamide |
| SMILES | O=C(COCCc1cccc2c(=O)[nH]ncc12)NC1CCN(c2ncc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C22H23F3N6O3/c23-22(24,25)15-10-26-21(27-11-15)31-7-4-16(5-8-31)29-19(32)13-34-9-6-14-2-1-3-17-18(14)12-28-30-20(17)33/h1-3,10-12,16H,4-9,13H2,(H,29,32)(H,30,33) |
| InChIKey | GHYHGZHMRUXQQF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|