C22H25N5O3 — CID 165392990
5-[2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]ethyl]-2H-phthalazin-1-one (PubChem CID 165392990) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is 5-[2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]ethyl]-2H-phthalazin-1-one.
| Compound Name | 5-[2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]ethyl]-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 165392990 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-[2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propoxy]ethyl]-2H-phthalazin-1-one |
| SMILES | O=C(CCOCCc1cccc2c(=O)[nH]ncc12)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C22H25N5O3/c28-21(27-12-10-26(11-13-27)20-6-1-2-9-23-20)8-15-30-14-7-17-4-3-5-18-19(17)16-24-25-22(18)29/h1-6,9,16H,7-8,10-15H2,(H,25,29) |
| InChIKey | HSNLUCOEOTVPJG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|